Skip to content

Introduction to Group Theory: The Axioms, and a Language for Computing with Symmetry

Prerequisite:The Grammar of Mathematics: Reading and Writing Sets and LogicVector Spaces and Linear Maps: From the Eight Axioms to the Rank-Nullity Theorem

Raw
  • A group is a set together with a binary operation on it, subject to only three conditions: associativity, the existence of an identity, and the existence of inverses. Precisely because there are only three, addition of integers, multiplication of matrices, composition of permutations, and the symmetry operations of a figure can all be handled in one language.
  • From these three we deduce the uniqueness of the identity and of inverses, the cancellation laws, and (ab)1=b1a1(ab)^{-1} = b^{-1}a^{-1}. The multiplication table of a finite group is a “Latin square”: every element occurs exactly once in each row and in each column.
  • (Z,+)(\mathbb{Z}, +) and (R{0},×)(\mathbb{R}\setminus\{0\}, \times) are commutative, but the symmetric group S3S_3 and the general linear group GL(2,R)GL(2,\mathbb{R}) are not. Group theory owes its richness to this noncommutativity.
  • The six elements of S3S_3 correspond one-to-one with the 3 rotations and 3 reflections of an equilateral triangle. Writing out the multiplication table in full makes the noncommutativity visible.
  • The order of an element aa is the least positive integer nn with an=ea^n = e. In a finite group every element has finite order, and am=ea^m = e is equivalent to “the order divides mm”.
  • A group generated by a single element is called cyclic, and every cyclic group is abelian. The converse fails: among abelian groups of order 4 there is one that is not cyclic (the Klein four-group).

1. Motivation: from “permuting the roots” of an equation to abstract groups

Section titled “1. Motivation: from “permuting the roots” of an equation to abstract groups”

Everyone knows the quadratic formula for ax2+bx+c=0ax^2+bx+c=0. Formulas exist for degrees 3 and 4 as well, complicated though they are. What about degree 5? The answer, which took more than two hundred years to reach, was: there is no general formula using only the four arithmetic operations and radicals.

The decisive change of viewpoint that led to this conclusion is due to Lagrange. In the 1770s he studied how many values a rational expression in the roots α1,,αn\alpha_1, \ldots, \alpha_n of an equation takes when the roots are permuted. For instance α1+α2+α3\alpha_1+\alpha_2+\alpha_3 is unchanged by every permutation and so takes a single value, whereas α1α2+α3\alpha_1\alpha_2 + \alpha_3 takes three values depending on the permutation. Lagrange’s insight was that whether a formula for the solutions can be built is decided by this behaviour under permutation.

The protagonist here is not the roots themselves but the totality of the permutations of the roots. Permutations can be performed one after another to give another permutation, each has a reverse, and there is one that does nothing. Ruffini and Abel proved that the general quintic is not solvable by radicals, and around 1830 Galois attached to each equation a collection of permutations — he called it a groupe — and saw that the structure of that collection completely determines solvability. For details see An invitation to Galois theory.

Later, in an 1854 paper, Cayley moved away from the concrete material of permutations and defined a group as “an abstract set equipped with a multiplication table”. By the end of the nineteenth century the axioms had been organized into the form seen in today’s textbooks. The dividend of abstraction was enormous. Compare the following four rows.

SetOperationThe “do nothing” elementThe “undo” element
Integers Z\mathbb{Z}addition ++00a-a
Nonzero real numbersmultiplication ×\times111/a1/a
Symmetry operations of an equilateral triangleperform one after anotherthe operation that moves nothingthe reverse operation
Invertible matricesmatrix productidentity matrix IIinverse matrix A1A^{-1}

The raw material is entirely different, yet the skeleton matches exactly. A group is what remains when only that skeleton is kept. So “learning group theory” means nothing other than proving theorems that apply simultaneously to all four rows. In this article we settle the axioms and the first examples; classification by substructure is taken up in Subgroups and cosets, and classification by structure-preserving maps in The isomorphism theorems for groups.


2. Preliminaries: binary operations and associativity

Section titled “2. Preliminaries: binary operations and associativity”

We assume the notation for sets and logic at the level of The grammar of mathematics — sets and logic. We begin by defining “operation” rigorously, as a map.

Definition 2.1Binary operation

A binary operation on a set GG is a map

μ:G×GG.\mu : G \times G \longrightarrow G .

We write μ(a,b)\mu(a,b) as aba \cdot b, or simply abab.

Saying that the domain is G×GG\times G and the codomain is GG already demands two things. First, that a value is assigned to every pair of elements of GG (an operation defined only partially is not a binary operation). Second, that this value again belongs to GG; this second condition is expressed by saying that ”GG is closed under the operation”. For example the odd numbers are not closed under addition (1+1=21+1=2 is not odd), so there is no binary operation “addition” on the set of odd numbers.

Combining three or more elements requires parentheses. The expression abca\cdot b\cdot c can be read either as (ab)c(ab)c or as a(bc)a(bc), and these two need not always agree. For real subtraction, for instance, (53)1=1(5-3)-1 = 1 while 5(31)=35-(3-1)=3. The requirement that the two always agree is called associativity. Associativity is not among the axioms merely because it is convenient: it holds because the prototype of all groups, composition of maps, satisfies it.

Proposition 2.2Associativity of composition of maps

For maps f,g,hf, g, h from a set XX to itself, (fg)h=f(gh)(f\circ g)\circ h = f\circ (g\circ h).

Proof(Proposition 2.2)

Two maps are equal precisely when their values agree at every point of the domain. Take an arbitrary xXx\in X. By the definition of composition,

((fg)h)(x)=(fg)(h(x))=f(g(h(x)))\bigl((f\circ g)\circ h\bigr)(x) = (f\circ g)\bigl(h(x)\bigr) = f\Bigl(g\bigl(h(x)\bigr)\Bigr)

and likewise

(f(gh))(x)=f((gh)(x))=f(g(h(x))).\bigl(f\circ (g\circ h)\bigr)(x) = f\bigl((g\circ h)(x)\bigr) = f\Bigl(g\bigl(h(x)\bigr)\Bigr) .

Both equal f(g(h(x)))f(g(h(x))), so the values agree for every xx. Hence the two maps are equal.

Given associativity, the product a1a2ana_1a_2\cdots a_n is determined independently of how parentheses are inserted (this is proved by induction on nn; it is a typical application of strong induction(Theorem 4.3)[Techniques of Proof] from Techniques of proof). Below we use this fact without comment and omit parentheses.


3. The definition of a group and its first consequences

Section titled “3. The definition of a group and its first consequences”

Definition 3.1Group and abelian group

A pair (G,)(G, \cdot) consisting of a set GG and a binary operation \cdot on it is a group when the following three conditions hold.

  • (G1) Associativity: (ab)c=a(bc)(ab)c = a(bc) for all a,b,cGa, b, c \in G.
  • (G2) Existence of an identity: there is an eGe \in G such that ea=ae=aea = ae = a for all aGa\in G.
  • (G3) Existence of inverses: for the ee of (G2), and for every aGa\in G, there is a bGb\in G with ab=ba=eab = ba = e.

If in addition

  • (G4) Commutativity: ab=baab = ba for all a,bGa,b\in G

holds, then GG is called an abelian group (or commutative group). When GG is a finite set, GG is called a finite group, and the number G|G| of its elements is called the order of GG.

There are only three axioms. Note that “the identity is unique” and “the inverse is unique” are not among them — because they need not be.

flowchart TB
A["Set with a binary operation only (magma)"] --> B["Semigroup (add associativity G1)"]
B --> C["Monoid (add an identity G2)"]
C --> D["Group (add inverses G3)"]
D --> E["Abelian group (add commutativity G4)"]
The hierarchy of algebraic systems: adding one condition at a time leads to a group.

Proposition 3.2Basic properties of groups

Let (G,)(G,\cdot) be a group. Then the following hold.

  1. The identity is unique: if ee and ee' both satisfy (G2), then e=ee = e'.
  2. For each aGa\in G the element bb satisfying (G3) is unique; we write it a1a^{-1}.
  3. (Cancellation laws) For a,x,yGa, x, y \in G: if ax=ayax = ay then x=yx = y, and if xa=yaxa = ya then x=yx=y.
  4. For all a,bGa, b\in G we have (a1)1=a(a^{-1})^{-1} = a and (ab)1=b1a1(ab)^{-1} = b^{-1}a^{-1}.
Proof(Proposition 3.2)

(1) Let ee and ee' both be identities. Applying the identity property of ee' with a=ea = e gives ee=ee e' = e. Applying the identity property of ee with a=ea = e' gives ee=ee e' = e'. The left-hand sides are the same, so e=ee = e'. All that was used is (G2), applied to each of the two elements.

(2) Suppose bb and bb' both satisfy ab=ba=eab = ba = e and ab=ba=eab' = b'a = e. Then

b=be=b(ab)=(ba)b=eb=b.b = be = b(ab') = (ba)b' = eb' = b' .

The first equality is (G2), the second is ab=eab' = e, the third is associativity (G1), the fourth is ba=eba = e, and the fifth is (G2) again.

(3) Suppose ax=ayax = ay. By (2) the inverse a1a^{-1} of aa is well determined, so multiplying on the left by it gives

x=ex=(a1a)x=a1(ax)=a1(ay)=(a1a)y=ey=y.x = ex = (a^{-1}a)x = a^{-1}(ax) = a^{-1}(ay) = (a^{-1}a)y = ey = y .

We used (G2), (G3) and (G1). If xa=yaxa = ya, multiply on the right by a1a^{-1} in the same way.

(4) The identity a1a=aa1=ea^{-1}a = a a^{-1} = e reads directly as ”aa is an inverse of a1a^{-1}”. By the uniqueness of inverses in (2), (a1)1=a(a^{-1})^{-1} = a. Next,

(ab)(b1a1)=a(b(b1a1))=a((bb1)a1)=a(ea1)=aa1=e(ab)(b^{-1}a^{-1}) = a\bigl(b(b^{-1}a^{-1})\bigr) = a\bigl((bb^{-1})a^{-1}\bigr) = a(ea^{-1}) = aa^{-1} = e

(using (G1) twice, then (G3) and (G2)), and likewise

(b1a1)(ab)=b1((a1a)b)=b1(eb)=b1b=e.(b^{-1}a^{-1})(ab) = b^{-1}\bigl((a^{-1}a)b\bigr) = b^{-1}(eb) = b^{-1}b = e .

So b1a1b^{-1}a^{-1} is an inverse of abab, and by uniqueness (2), (ab)1=b1a1(ab)^{-1} = b^{-1}a^{-1}.

The reversal of order in (4) matters. The way to undo “put on socks, then put on shoes” is “take off shoes, then take off socks”: the order is reversed.

Corollary 3.3The multiplication table is a Latin square

Let G={g1,,gn}G = \{g_1, \ldots, g_n\} be a finite group, and form the n×nn\times n table (the multiplication table, or Cayley table) whose (i,j)(i,j) entry is gigjg_ig_j. Then every element of GG appears exactly once in each row and exactly once in each column.

Proof(Corollary 3.3)

Fix gGg\in G and define a map λg:GG\lambda_g : G\to G by λg(x)=gx\lambda_g(x) = gx. Composing with λg1\lambda_{g^{-1}}, we get, for every xx,

λg1(λg(x))=g1(gx)=(g1g)x=ex=x\lambda_{g^{-1}}\bigl(\lambda_g(x)\bigr) = g^{-1}(gx) = (g^{-1}g)x = ex = x

(using (G1), (G3) and (G2)), and similarly λg(λg1(x))=x\lambda_g(\lambda_{g^{-1}}(x)) = x. Hence λg\lambda_g is a bijection with inverse λg1\lambda_{g^{-1}}. The entries in the ii-th row of the table are λgi(g1),,λgi(gn)\lambda_{g_i}(g_1), \ldots, \lambda_{g_i}(g_n), so, being the image of a bijection, they consist of all elements of GG, each occurring exactly once. For columns, run the same argument with ρg(x)=xg\rho_g(x) = xg.

This corollary is useful in practice: if, after writing out a multiplication table, some element appears twice in a row, a computation has gone wrong somewhere.


4. A catalogue of examples: commutative groups and noncommutative ones

Section titled “4. A catalogue of examples: commutative groups and noncommutative ones”

Staring at the axioms will not teach you what a group is. Here are examples, alongside non-examples.

Example 4.1Groups made from sets of numbers, and things that are not groups

Groups.

  • (Z,+)(\mathbb{Z}, +), (Q,+)(\mathbb{Q},+), (R,+)(\mathbb{R},+), (C,+)(\mathbb{C},+): the identity is 00 and the inverse of aa is a-a. All are abelian.
  • (Q{0},×)(\mathbb{Q}\setminus\{0\}, \times), (R{0},×)(\mathbb{R}\setminus\{0\},\times), (C{0},×)(\mathbb{C}\setminus\{0\},\times): the identity is 11 and the inverse of aa is 1/a1/a. Without removing 00 there would be no inverse for 00 and (G3) would fail. These are abelian.
  • (R>0,×)(\mathbb{R}_{>0}, \times): all positive reals. Closed under multiplication, and a>0a>0 implies 1/a>01/a>0, so inverses stay inside.
  • A vector space VV over a field KK is an abelian group under addition (the part of the definition of a vector space(Definition 3.1)[Vector Spaces and Linear Maps] in Vector spaces and linear transformations that concerns addition is exactly (G1)–(G4)).

Not groups.

  • (N,+)(\mathbb{N}, +) with N={1,2,}\mathbb{N} = \{1,2,\ldots\}: the identity 00 is missing. Even after adjoining 00, the inverse 1-1 of 11 is not present, so (G3) fails.
  • (Z{0},×)(\mathbb{Z}\setminus\{0\}, \times): associativity holds and 11 is an identity, but 22 has no inverse, since 1/2Z1/2 \notin \mathbb{Z}.
  • (R,)(\mathbb{R}, -) with subtraction: (53)1=13=5(31)(5-3)-1 = 1 \ne 3 = 5-(3-1), so (G1) fails.

The next example is the most basic source of finite groups. For equivalence relations and quotient sets we follow Relations and equivalence relations.

Example 4.2Groups from congruence of integers

Let nn be a positive integer. Integers a,ba, b are congruent modulo nn when nabn \mid a-b, written ab(modn)a\equiv b \pmod n. This is an equivalence relation on Z\mathbb{Z} (see congruence mod n is an equivalence relation(Proposition 3.4)[関係と同値関係]); we write the equivalence class of aa as [a]={a+kn:kZ}[a] = \{a + kn : k\in\mathbb{Z}\} and the set of all classes as Z/nZ\mathbb{Z}/n\mathbb{Z}. Then Z/nZ={[0],[1],,[n1]}\mathbb{Z}/n\mathbb{Z} = \{[0],[1],\ldots,[n-1]\}, which has nn elements.

Checking that addition is well defined. We want to set [a]+[b]:=[a+b][a]+[b] := [a+b], but the answer must not depend on the choice of representatives. Suppose [a]=[a][a]=[a'] and [b]=[b][b]=[b'], so naan \mid a-a' and nbbn\mid b-b'. Then

(a+b)(a+b)=(aa)+(bb)(a+b)-(a'+b') = (a-a') + (b-b')

is also divisible by nn, whence [a+b]=[a+b][a+b] = [a'+b']. So addition is unambiguously defined.

Checking the group axioms. Associativity reduces to associativity of integer addition: ([a]+[b])+[c]=[(a+b)+c]=[a+(b+c)]=[a]+([b]+[c])([a]+[b])+[c] = [(a+b)+c] = [a+(b+c)] = [a]+([b]+[c]). The identity is [0][0], and the inverse of [a][a] is [a][-a]. Since [a]+[b]=[a+b]=[b+a]=[b]+[a][a]+[b]=[a+b]=[b+a]=[b]+[a], the group is abelian. We have obtained a finite abelian group (Z/nZ,+)(\mathbb{Z}/n\mathbb{Z}, +) of order nn.

The multiplicative group. Multiplication [a][b]:=[ab][a][b] := [ab] is well defined by the same argument. However, all of Z/nZ\mathbb{Z}/n\mathbb{Z} is not a group under multiplication, since [0][0] has no inverse. The class [a][a] has a multiplicative inverse if and only if gcd(a,n)=1\gcd(a,n)=1. Indeed, if gcd(a,n)=1\gcd(a,n)=1 then by Bézout’s identity there are integers x,yx,y with ax+ny=1ax+ny=1, and [a][x]=[1ny]=[1][a][x]=[1-ny]=[1]. Conversely, if [a][x]=[1][a][x]=[1] then ax1=nyax-1 = ny, and gcd(a,n)\gcd(a,n) divides the left-hand side of axny=1ax-ny=1, so it equals 11. Setting

(Z/nZ)×:={[a]:gcd(a,n)=1},(\mathbb{Z}/n\mathbb{Z})^{\times} := \{[a] : \gcd(a,n)=1\} ,

we obtain an abelian group under multiplication (closure follows from the fact that gcd(a,n)=gcd(b,n)=1\gcd(a,n)=\gcd(b,n)=1 implies gcd(ab,n)=1\gcd(ab,n)=1). For instance, when n=8n=8 we get (Z/8Z)×={[1],[3],[5],[7]}(\mathbb{Z}/8\mathbb{Z})^\times = \{[1],[3],[5],[7]\}, of order 4.

Everything so far has been commutative. We now turn to a noncommutative example.

Example 4.3The general linear group GL(2,R)

Write GL(2,R)GL(2,\mathbb{R}) for the set of all 2×22\times 2 real matrices with detA0\det A \ne 0, with matrix multiplication as the operation.

Noncommutativity. Put A=(1101)A = \begin{pmatrix}1&1\\0&1\end{pmatrix} and B=(1011)B = \begin{pmatrix}1&0\\1&1\end{pmatrix} (both of determinant 11). Then

AB=(1101)(1011)=(2111),BA=(1011)(1101)=(1112)AB = \begin{pmatrix}1&1\\0&1\end{pmatrix}\begin{pmatrix}1&0\\1&1\end{pmatrix} = \begin{pmatrix}2&1\\1&1\end{pmatrix}, \qquad BA = \begin{pmatrix}1&0\\1&1\end{pmatrix}\begin{pmatrix}1&1\\0&1\end{pmatrix} = \begin{pmatrix}1&1\\1&2\end{pmatrix}

so ABBAAB \ne BA. Hence GL(2,R)GL(2,\mathbb{R}) is not abelian.

Note also that the set M2(R)M_2(\mathbb{R}) of all 2×22\times 2 real matrices is not a group under multiplication: the zero matrix OO has detO=0\det O = 0, and there is no XX with OX=IOX = I. It is precisely the step of “collecting only the invertible ones” that makes (G3) hold.

Remark 4.4

If we considered only commutative groups, group theory would come to an end rather quickly (the theorem that a finite abelian group decomposes as a direct product of cyclic groups almost exhausts the subject). The symmetries that actually occur in mathematics — permutations of the roots of an equation, rotations of space, the symmetry operations of a crystal — are mostly noncommutative. Rotations and reflections give different results when their order is swapped, and two moves of a Rubik’s cube do not commute either. Noncommutativity is not an inconvenient exception; it is the very thing group theory is meant to handle.


5. Symmetric groups and the symmetry of an equilateral triangle

Section titled “5. Symmetric groups and the symmetry of an equilateral triangle”

Last, and most important, we construct the group formed by the “rearrangements” of a set.

Theorem 5.1Symmetric group

Let XX be a nonempty set and let Sym(X)\operatorname{Sym}(X) denote the set of all bijections from XX to XX. Then Sym(X)\operatorname{Sym}(X) is a group under composition \circ.

Proof(Theorem 5.1)

Closure. Let f,gSym(X)f, g \in \operatorname{Sym}(X). That fgf\circ g is injective follows because (fg)(x)=(fg)(y)(f\circ g)(x) = (f\circ g)(y), that is f(g(x))=f(g(y))f(g(x)) = f(g(y)), gives g(x)=g(y)g(x)=g(y) by injectivity of ff and then x=yx = y by injectivity of gg. That it is surjective follows because, for any zXz\in X, surjectivity of ff provides a yy with f(y)=zf(y)=z and surjectivity of gg provides an xx with g(x)=yg(x)=y, so that (fg)(x)=z(f\circ g)(x) = z. Hence fgSym(X)f\circ g\in\operatorname{Sym}(X).

(G1): Proposition 2.2 applies verbatim.

(G2): the identity map idX\mathrm{id}_X is a bijection, and for every ff and every xx we have (idXf)(x)=f(x)(\mathrm{id}_X\circ f)(x) = f(x) and (fidX)(x)=f(x)(f\circ \mathrm{id}_X)(x) = f(x), so idXf=fidX=f\mathrm{id}_X\circ f = f\circ\mathrm{id}_X = f.

(G3): if ff is a bijection then the inverse map f1f^{-1} exists and is again a bijection (its own inverse being ff). By definition ff1=f1f=idXf\circ f^{-1} = f^{-1}\circ f = \mathrm{id}_X.

Definition 5.2Permutations and the symmetric group

When X={1,2,,n}X = \{1,2,\ldots,n\}, the group Sym(X)\operatorname{Sym}(X) is called the symmetric group of degree nn and is written SnS_n; its elements are called permutations. A permutation σ\sigma is written

σ=(12nσ(1)σ(2)σ(n)),\sigma = \begin{pmatrix} 1 & 2 & \cdots & n \\ \sigma(1) & \sigma(2) & \cdots & \sigma(n)\end{pmatrix} ,

and also, when it cycles i1i2iki1i_1 \mapsto i_2 \mapsto \cdots \mapsto i_k \mapsto i_1 and fixes everything else, as (i1i2ik)(i_1\, i_2\, \cdots\, i_k) (a cycle of length kk). A cycle (i j)(i\ j) of length 2 is called a transposition.

Theorem 5.3Order and noncommutativity of the symmetric group

Let nn be a positive integer.

  1. Sn=n!|S_n| = n!.
  2. If n3n \ge 3 then SnS_n is not abelian.
Proof(Theorem 5.3)

(1) We argue by induction on nn. For n=1n=1, S1S_1 consists of the identity map alone, so S1=1=1!|S_1| = 1 = 1!. Let n2n\ge 2 and assume Sn1=(n1)!|S_{n-1}| = (n-1)!. Classify the elements of SnS_n by the value of σ(n)\sigma(n), which can be any of the nn values 1,,n1,\ldots,n. Fix kk and put Ak={σSn:σ(n)=k}A_k = \{\sigma\in S_n : \sigma(n) = k\}. Using the transposition τk=(k n)\tau_k = (k\ n) (the identity when k=nk=n), define a map AkAnA_k \to A_n by στkσ\sigma\mapsto \tau_k\sigma; since (τkσ)(n)=τk(k)=n(\tau_k\sigma)(n) = \tau_k(k) = n, the image does lie in AnA_n. Because τkτk=id\tau_k\tau_k = \mathrm{id}, the map ρτkρ\rho\mapsto\tau_k\rho is an inverse for it, so AkA_k and AnA_n have the same number of elements. On the other hand AnA_n is the set of permutations fixing nn, which may be identified with the set of all bijections of {1,,n1}\{1,\ldots,n-1\}, so An=(n1)!|A_n| = (n-1)! by the induction hypothesis. The sets A1,,AnA_1,\ldots,A_n are pairwise disjoint with union all of SnS_n, so

Sn=k=1nAk=n(n1)!=n!.|S_n| = \sum_{k=1}^{n} |A_k| = n\cdot (n-1)! = n! .

(2) Let n3n\ge 3 and regard σ=(1 2)\sigma = (1\ 2) and τ=(2 3)\tau = (2\ 3) as elements of SnS_n (they fix every number 4\ge 4). Then

(στ)(1)=σ(τ(1))=σ(1)=2,(τσ)(1)=τ(σ(1))=τ(2)=3.(\sigma\tau)(1) = \sigma(\tau(1)) = \sigma(1) = 2, \qquad (\tau\sigma)(1) = \tau(\sigma(1)) = \tau(2) = 3 .

The values at 11 differ, so σττσ\sigma\tau \ne \tau\sigma and (G4) fails.

5.1. The multiplication table of the symmetric group of degree 3

Section titled “5.1. The multiplication table of the symmetric group of degree 3”

We write out the case n=3n=3 completely. By Theorem 5.3, S3=3!=6|S_3| = 3! = 6. Name the elements as follows.

e=id,r=(123),r2=(132),a=(23),b=(13),c=(12)e = \mathrm{id},\quad r = (1\,2\,3),\quad r^2 = (1\,3\,2),\quad a = (2\,3),\quad b = (1\,3),\quad c = (1\,2)

Let us verify that r2r^2 is (132)(1\,3\,2). Since rr sends 12311\mapsto 2\mapsto 3\mapsto 1, we get r2(1)=r(r(1))=r(2)=3r^2(1) = r(r(1)) = r(2) = 3, r2(3)=r(r(3))=r(1)=2r^2(3) = r(r(3)) = r(1) = 2, and r2(2)=r(3)=1r^2(2) = r(3) = 1. That is, 13211\mapsto 3\mapsto 2\mapsto 1, which is (132)(1\,3\,2). In the same way one checks r3=er^3 = e.

As a representative computation, take rara. First apply a=(23)a=(2\,3), then apply rr.

1 a 1 r 2,2 a 3 r 1,3 a 2 r 3.\begin{aligned} 1 &\xmapsto{\ a\ } 1 \xmapsto{\ r\ } 2, \\ 2 &\xmapsto{\ a\ } 3 \xmapsto{\ r\ } 1, \\ 3 &\xmapsto{\ a\ } 2 \xmapsto{\ r\ } 3. \end{aligned}

Hence rara sends 121\mapsto 2, 212\mapsto 1, 333\mapsto 3, that is, ra=(12)=cra = (1\,2) = c. Computing arar the same way, 1r2a31\xmapsto{r}2\xmapsto{a}3, 2r3a22\xmapsto{r}3\xmapsto{a}2, 3r1a13\xmapsto{r}1\xmapsto{a}1, so ar=(13)=bar = (1\,3) = b. Since ra=cra = c and ar=bar = b are different, S3S_3 is not commutative.

Example 5.4The multiplication table of the symmetric group of degree 3

Computing all products by the same procedure yields the following table. The (i,j)(i,j) entry is “row element \cdot column element” (the row element being applied second).

\cdoteerrr2r^2aabbcc
eeeerrr2r^2aabbcc
rrrrr2r^2eeccaabb
r2r^2r2r^2eerrbbccaa
aaaabbcceerrr2r^2
bbbbccaar2r^2eerr
ccccaabbrrr2r^2ee

A check. As Corollary 3.3 asserts, each of e,r,r2,a,b,ce, r, r^2, a, b, c occurs exactly once in every row and every column. For instance row bb reads b,c,a,r2,e,rb, c, a, r^2, e, r, which lists all six elements, and column aa reads a,c,b,e,r2,ra, c, b, e, r^2, r, again all six.

Confirming noncommutativity. The table is not symmetric about the diagonal: the (r,a)(r,a) entry is cc while the (a,r)(a,r) entry is bb. In general, elements of {e,r,r2}\{e,r,r^2\} do not commute with elements of {a,b,c}\{a,b,c\}.

Partial commutativity. On the other hand the upper-left 3×33\times 3 block (products among e,r,r2e, r, r^2) is symmetric. These three elements are closed under the operation and form, by themselves, a commutative group of order 3. This is our first example of a “subgroup”, treated in earnest in Subgroups and cosets.

5.2. Reinterpretation as the symmetry of an equilateral triangle

Section titled “5.2. Reinterpretation as the symmetry of an equilateral triangle”

S3S_3 has a geometric meaning. Label the vertices of an equilateral triangle 1,2,31,2,3 and consider the congruences (symmetry operations) that map the triangle onto itself. Each symmetry operation induces a rearrangement of the vertex set, so it corresponds to an element of S3S_3. Conversely, all six rearrangements do come from actual symmetry operations.

123r(2 3)(1 3)(1 2)
Symmetries of an equilateral triangle. The three dashed lines are the mirror axes through vertices 1, 2 and 3, corresponding to the transpositions (2 3), (1 3) and (1 2). The arrow at the centre is the 120-degree rotation r = (1 2 3).

The correspondence is as follows.

Element of S3S_3CycleGeometric operation
eeleave the triangle alone
rr(123)(1\,2\,3)rotation by 120120^\circ about the centre
r2r^2(132)(1\,3\,2)rotation by 240240^\circ about the centre
aa(23)(2\,3)reflection in the axis through vertex 1
bb(13)(1\,3)reflection in the axis through vertex 2
cc(12)(1\,2)reflection in the axis through vertex 3

The equation ra=cra = c states the geometric fact that “flip in the axis through vertex 1, then rotate by 120120^\circ” is the same operation as “flip in the axis through vertex 3”. And ar=bar = b shows that reversing the order gives a different reflection. Compare the abstract multiplication table with what happens when you turn a triangle over in your hands. This group is also known as the dihedral group D3D_3 of the equilateral triangle.


6. The order of an element, and cyclic groups

Section titled “6. The order of an element, and cyclic groups”

We now consider multiplying an element aa of a group by itself repeatedly. First we define powers: a0:=ea^0 := e, an:=an1aa^{n} := a^{n-1}a for n1n \ge 1, and an:=(a1)na^{-n} := (a^{-1})^{n}. With these definitions, for all integers m,nm, n,

am+n=aman,(am)n=amna^{m+n} = a^m a^n, \qquad (a^m)^n = a^{mn}

hold (for m,n0m,n\ge 0 by induction on nn; for negative exponents by a case analysis using part (4) of Proposition 3.2). We use these freely below.

Definition 6.1Order of an element

Let aa be an element of a group GG. If there is a positive integer nn with an=ea^n = e, the least such nn is called the order of aa and written ord(a)\operatorname{ord}(a). If no such nn exists, we say aa has infinite order and write ord(a)=\operatorname{ord}(a) = \infty.

We have ord(a)=1\operatorname{ord}(a) = 1 only for a=ea = e (since a1=a=ea^1 = a = e). An element of order 2 is one with aea \ne e and a2=ea^2 = e, that is, a1=aa^{-1} = a. The reflections a,b,ca, b, c in S3S_3 are of this kind.

Proposition 6.2Elements of a finite group have finite order

Let GG be a finite group and aGa\in G. Then ord(a)\operatorname{ord}(a) is finite and ord(a)G\operatorname{ord}(a)\le |G|.

Proof(Proposition 6.2)

Put G=N|G| = N and consider the N+1N+1 elements a0,a1,a2,,aNa^0, a^1, a^2, \ldots, a^{N}. All lie in GG, but GG has only NN elements. By the pigeonhole principle there are indices 0i<jN0\le i < j \le N with ai=aja^i = a^j. Multiplying both sides on the left by (ai)1=ai(a^{i})^{-1} = a^{-i} and using the laws of exponents,

e=aiai=aiaj=ajie = a^{-i}a^{i} = a^{-i}a^{j} = a^{j-i}

(one may equally view this as an application of the cancellation law, part (3) of Proposition 3.2). Here 1jiN1 \le j-i \le N, so a positive integer nn with an=ea^n = e does exist, and the least such, ord(a)\operatorname{ord}(a), is at most jiN=Gj-i \le N = |G|.

Theorem 6.3Testing powers by the order

Let GG be a group and aGa\in G with ord(a)=n\operatorname{ord}(a) = n finite. Then for every integer mm,

am=e    nm.a^m = e \iff n \mid m .
Proof(Theorem 6.3)

(\Leftarrow) If nmn\mid m then m=nqm = nq for some integer qq, and by the laws of exponents am=(an)q=eq=ea^m = (a^n)^q = e^q = e (that eq=ee^q = e follows by induction when q0q\ge 0, and from e1=ee^{-1}=e when q<0q<0).

(\Rightarrow) Suppose am=ea^m = e. By the division theorem for integers there are unique integers q,sq, s with m=qn+sm = qn + s and 0s<n0\le s < n. Then

e=am=aqn+s=(an)qas=eqas=as.e = a^m = a^{qn+s} = (a^n)^q a^s = e^q a^s = a^s .

If s>0s > 0, then as=ea^s = e with 0<s<n0 < s < n, contradicting that n=ord(a)n = \operatorname{ord}(a) is the least positive integer kk with ak=ea^k = e. Hence s=0s = 0, that is m=qnm = qn, so nmn\mid m.

This theorem replaces the question “is a100=ea^{100} = e?” by the arithmetic question “does the order divide 100100?”. In a group of order 6, the corollary of Lagrange’s theorem we shall meet later (the order of an element divides the order of the group(Corollary 7.1)[Subgroups and Cosets]) restricts element orders to 1,2,3,61,2,3,6, which makes computations much easier.

Definition 6.4Generated subgroup and cyclic group

For an element aa of a group GG, put

a:={ak:kZ}\langle a\rangle := \{a^k : k \in \mathbb{Z}\}

and call it the set generated by aa. It is closed under the operation of GG (since aiaj=ai+ja^ia^j = a^{i+j}), contains e=a0e = a^0, and contains the inverse aka^{-k} of aka^k, so it is itself a group. If G=aG = \langle a\rangle for some element aa, then GG is called a cyclic group and aa a generator of it.

Proposition 6.5Structure of cyclic groups

Let GG be a group and aGa\in G.

  1. If ord(a)=n\operatorname{ord}(a) = n is finite, then a={e,a,a2,,an1}\langle a\rangle = \{e, a, a^2, \ldots, a^{n-1}\} and these nn elements are pairwise distinct. In particular a=ord(a)|\langle a\rangle| = \operatorname{ord}(a).
  2. If ord(a)=\operatorname{ord}(a) = \infty, then aiaja^i \ne a^j for integers iji \ne j, and a\langle a\rangle is infinite.
  3. Every cyclic group is abelian.
Proof(Proposition 6.5)

(1) For any integer kk, the division theorem gives k=qn+sk = qn+s with 0s<n0\le s<n. The same computation as in the proof of Theorem 6.3 gives ak=(an)qas=asa^k = (a^n)^qa^s = a^s. Hence a{e,a,,an1}\langle a\rangle \subseteq \{e,a,\ldots,a^{n-1}\}. The reverse inclusion holds because each asa^s for s=0,1,,n1s = 0,1,\ldots,n-1 is exactly the case k=sk = s of the definition. So the two sets are equal. Next, suppose 0i<jn10\le i<j\le n-1 with ai=aja^i = a^j; then aji=ea^{j-i} = e with 0<jin1<n0 < j-i \le n-1 < n, contradicting the minimality of nn. Hence the nn elements are distinct.

(2) If ai=aja^i = a^j with i<ji<j, then aji=ea^{j-i} = e with ji>0j-i>0, so aa would have finite order, contrary to hypothesis. Hence all powers are distinct and a\langle a\rangle is an infinite set of the same cardinality as Z\mathbb{Z}.

(3) Let G=aG = \langle a\rangle. Any two elements can be written ai,aja^i, a^j, and by the laws of exponents together with commutativity of integer addition,

aiaj=ai+j=aj+i=ajai.a^ia^j = a^{i+j} = a^{j+i} = a^ja^i .

Hence (G4) holds.

Taking the contrapositive, a noncommutative group is not cyclic. Since S3S_3 is noncommutative by Theorem 5.3, S3S_3 is not cyclic. Indeed, no element of S3S_3 has powers that produce all six elements. The next example confirms this.

Example 6.6Computing orders

The case of S3S_3. We find the order of each element using the table of Example 5.4.

  • ee: e1=ee^1 = e, so ord(e)=1\operatorname{ord}(e) = 1.
  • rr: r2er^2 \ne e, and r3=r2rr^3 = r^2\cdot r, whose entry (r2,r)(r^2, r) in the table is ee. Hence ord(r)=3\operatorname{ord}(r) = 3. Similarly ord(r2)=3\operatorname{ord}(r^2) = 3 (since (r2)2=r(r^2)^2 = r and (r2)3=e(r^2)^3 = e).
  • aa: the (a,a)(a,a) entry is ee, so a2=ea^2 = e, and aea\ne e, giving ord(a)=2\operatorname{ord}(a) = 2. Likewise bb and cc have order 2.

So the orders are 1,3,3,2,2,21,3,3,2,2,2. The largest is 3, short of S3=6|S_3| = 6. By part (1) of Proposition 6.5, x=ord(x)3<6|\langle x\rangle| = \operatorname{ord}(x) \le 3 < 6, so xS3\langle x\rangle \ne S_3 for every xx; that is, S3S_3 is not cyclic. Note that r={e,r,r2}\langle r\rangle = \{e,r,r^2\} and a={e,a}\langle a\rangle = \{e,a\}.

The case of Z/12Z\mathbb{Z}/12\mathbb{Z}. This is an additive group, so powers are written m[k]=[mk]m[k] = [mk]. Putting d=gcd(k,12)d = \gcd(k,12), we have

ord([k])=12d.\operatorname{ord}([k]) = \frac{12}{d} .

Here is why. The condition m[k]=[0]m[k] = [0] is equivalent to 12mk12 \mid mk. Writing 12=d(12/d)12 = d\cdot(12/d) and k=d(k/d)k = d\cdot(k/d), the condition 12mk12\mid mk is equivalent to (12/d)m(k/d)(12/d) \mid m(k/d). Since gcd(12/d,k/d)=1\gcd(12/d, k/d) = 1, this is in turn equivalent to (12/d)m(12/d)\mid m, whose least positive solution mm is 12/d12/d. Carrying out the computation gives the following table.

kk01234567891011
gcd(k,12)\gcd(k,12)1212341614321
ord([k])\operatorname{ord}([k])1126431221234612

There are four elements of order 12, namely [1],[5],[7],[11][1],[5],[7],[11], and these are the generators. For instance [5]\langle [5]\rangle runs through [5],[10],[3],[8],[1],[6],[11],[4],[9],[2],[7],[0][5],[10],[3],[8],[1],[6],[11],[4],[9],[2],[7],[0] — all twelve elements — and so equals all of Z/12Z\mathbb{Z}/12\mathbb{Z}. The generators correspond to those kk coprime to 1212, and their number is Euler’s totient φ(12)=4\varphi(12) = 4.

Example 6.7Groups of order 4: the cyclic group and the Klein four-group

Here is the smallest instance of the phenomenon that two groups can have the same order and yet differ as groups.

Z/4Z\mathbb{Z}/4\mathbb{Z}. By the same computation as in Example 6.6, ord([1])=4\operatorname{ord}([1]) = 4. So [1]\langle [1]\rangle has 4 elements and equals all of Z/4Z\mathbb{Z}/4\mathbb{Z}. This group is cyclic.

(Z/8Z)×={[1],[3],[5],[7]}(\mathbb{Z}/8\mathbb{Z})^\times = \{[1],[3],[5],[7]\}. As seen in Example 4.2, this is a group of order 4. Compute the square of each element:

32=9=8+1,52=25=38+1,72=49=68+13^2 = 9 = 8+1,\qquad 5^2 = 25 = 3\cdot 8 + 1, \qquad 7^2 = 49 = 6\cdot 8+1

so [3]2=[5]2=[7]2=[1][3]^2 = [5]^2 = [7]^2 = [1]. That is, all three non-identity elements have order 2, and there is no element of order 4. By part (1) of Proposition 6.5, x=ord(x)2<4|\langle x\rangle| = \operatorname{ord}(x)\le 2 < 4, so this group is not cyclic. It is called the Klein four-group. Its multiplication table is as follows.

\cdot[1][1][3][3][5][5][7][7]
[1][1][1][1][3][3][5][5][7][7]
[3][3][3][3][1][1][7][7][5][5]
[5][5][5][5][7][7][1][1][3][3]
[7][7][7][7][5][5][3][3][1][1]

(For example 35=15=8+73\cdot 5 = 15 = 8+7, so [3][5]=[7][3][5] = [7]. The table is symmetric about the diagonal, which shows that the group is abelian.)

So there are two kinds of abelian group of order 4. To assert that there are genuinely “two kinds”, we must formalize what it means for Z/4Z\mathbb{Z}/4\mathbb{Z} and the Klein four-group to be essentially different. That is the notion of isomorphism (isomorphisms and isomorphic groups(Definition 3.2)[群の準同型定理]), the subject of The isomorphism theorems for groups. For now, understand that the two are distinguished by the property “is there an element of order 4?”, which does not change under any renaming of elements.

Remark 6.8

We now have the axioms of a group, its basic properties, a representative supply of examples, and the notions of order and cyclic group. At the next stage we learn how to divide a whole group by a small group contained in it (a subgroup). In Subgroups and cosets we prove Lagrange’s theorem, that the order of a subgroup divides the order of the whole group, and in Normal subgroups and quotient groups we put a group structure on the set of cosets itself (quotient group(Theorem 5.1)[Normal Subgroups and Quotient Groups]). Going further, objects carrying not one but two operations (addition and multiplication) lead to Foundations of rings and fields. The fact that Z/nZ\mathbb{Z}/n\mathbb{Z} appeared both as an additive group and as an object with a multiplication was a foretaste of this.


Exercise 7.1Easy

Suppose every element xx of a group GG satisfies x2=ex^2 = e. Show that GG is abelian.

Solution

First, for any xGx\in G the relation x2=ex^2 = e reads xx=exx = e, so by the definition of an inverse, x1=xx^{-1} = x (and by the uniqueness of inverses, part (2) of Proposition 3.2, there is no other inverse of xx).

Take arbitrary a,bGa,b\in G. The hypothesis applies to abGab\in G as well, so (ab)1=ab(ab)^{-1} = ab. On the other hand part (4) of Proposition 3.2 gives (ab)1=b1a1(ab)^{-1} = b^{-1}a^{-1}, and by what we just showed b1=bb^{-1} = b and a1=aa^{-1} = a. Hence

ab=(ab)1=b1a1=ba,ab = (ab)^{-1} = b^{-1}a^{-1} = ba ,

so (G4) holds and GG is abelian.

(The Klein four-group, Example 6.7, is an example satisfying this condition. By contrast Z/4Z\mathbb{Z}/4\mathbb{Z} does not, since [1]+[1]=[2][0][1]+[1] = [2]\ne [0].)

Exercise 7.2Standard

Using the multiplication table of Example 5.4, compute xax1xax^{-1} for every element xx of S3S_3, where a=(23)a = (2\,3). What can you conclude from the result?

Solution

First read off the inverses from the table: e1=ee^{-1}=e, r1=r2r^{-1} = r^2 (since rr2=err^2 = e), (r2)1=r(r^2)^{-1} = r, a1=aa^{-1}=a, b1=bb^{-1}=b, c1=cc^{-1}=c.

  • x=ex = e: eae1=aeae^{-1} = a.
  • x=rx = r: rar1=(ra)r2rar^{-1} = (ra)r^2. From the table ra=cra = c, and the (c,r2)(c, r^2) entry is bb, so rar1=brar^{-1} = b.
  • x=r2x = r^2: since (r2)1=r(r^2)^{-1} = r, we have r2a(r2)1=(r2a)rr^2a(r^2)^{-1} = (r^2a)r. From the table r2a=br^2a = b, and the (b,r)(b,r) entry is cc, so r2a(r2)1=cr^2a(r^2)^{-1} = c.
  • x=ax = a: aaa1=aaaa^{-1} = a (from aa=eaa = e and then ea=aea = a).
  • x=bx = b: bab1=(ba)bbab^{-1} = (ba)b. From the table ba=r2ba = r^2, and the (r2,b)(r^2, b) entry is cc, so bab1=cbab^{-1} = c.
  • x=cx = c: cac1=(ca)ccac^{-1} = (ca)c. From the table ca=rca = r, and the (r,c)(r,c) entry is bb, so cac1=bcac^{-1} = b.

Every result is one of a,b,ca, b, c; we never leave {a,b,c}\{a,b,c\}. In other words, the set {a,b,c}\{a,b,c\} of all reflections is closed under the operation gxgx1g \mapsto xgx^{-1} (conjugation). The element aa had order 2, and the elements b,cb, c obtained also have order 2. This is no accident: since (xax1)k=xakx1(xax^{-1})^k = xa^kx^{-1}, conjugation preserves order. Conjugation plays a central role in Normal subgroups and quotient groups.

Exercise 7.3Standard

For the elements

A=(0110),B=(1101)A = \begin{pmatrix} 0 & -1 \\ 1 & 0\end{pmatrix}, \qquad B = \begin{pmatrix} 1 & 1 \\ 0 & 1 \end{pmatrix}

of GL(2,R)GL(2,\mathbb{R}), determine ord(A)\operatorname{ord}(A) and ord(B)\operatorname{ord}(B).

Solution

Both have determinant 11, so both lie in GL(2,R)GL(2,\mathbb{R}).

For AA. Compute in turn:

A2=(0110)(0110)=(1001)=I.A^2 = \begin{pmatrix} 0 & -1 \\ 1 & 0\end{pmatrix}\begin{pmatrix} 0 & -1 \\ 1 & 0\end{pmatrix} = \begin{pmatrix} -1 & 0 \\ 0 & -1\end{pmatrix} = -I .

Hence A3=A2A=AIA^3 = A^2A = -A \ne I and A4=(A2)2=(I)2=IA^4 = (A^2)^2 = (-I)^2 = I. Since AIA\ne I, A2=IIA^2 = -I \ne I, A3=AIA^3 = -A\ne I and A4=IA^4 = I, we get ord(A)=4\operatorname{ord}(A) = 4. (Here AA is the matrix of the 9090^\circ rotation about the origin, so this agrees with the geometric fact that four turns bring you back to the start.)

For BB. We show by induction on nn that for every positive integer nn,

Bn=(1n01).B^n = \begin{pmatrix} 1 & n \\ 0 & 1\end{pmatrix} .

The case n=1n=1 is the definition. Assuming BnB^n has the stated form,

Bn+1=BnB=(1n01)(1101)=(1n+101)B^{n+1} = B^nB = \begin{pmatrix}1 & n\\ 0 & 1\end{pmatrix}\begin{pmatrix}1&1\\0&1\end{pmatrix} = \begin{pmatrix}1 & n+1 \\ 0 & 1\end{pmatrix}

which proves the claim. Therefore, for n1n\ge 1 the (1,2)(1,2) entry is n0n \ne 0, so BnIB^n \ne I. Hence ord(B)=\operatorname{ord}(B) = \infty.

This exercise shows that the hypothesis “finite group” in Proposition 6.2 cannot be dropped. Inside the infinite group GL(2,R)GL(2,\mathbb{R}), elements of finite order and elements of infinite order live side by side.

Exercise 7.4Hard

Let GG be a nonempty finite set equipped with an associative binary operation which in addition satisfies the two-sided cancellation laws

ax=ayx=y,xa=yax=y(a,x,yG).ax = ay \Rightarrow x = y, \qquad xa = ya \Rightarrow x = y \qquad (a,x,y\in G) .

Show that GG is a group. Also show by a counterexample that the assertion fails when GG is infinite.

Solution

Existence of an identity. Fix an element aGa\in G. The map λa:GG\lambda_a : G\to G, λa(x)=ax\lambda_a(x) = ax, is injective, immediately by the left cancellation law. Since GG is finite and λa\lambda_a maps GG to GG, injectivity implies surjectivity. Likewise ρa(x)=xa\rho_a(x) = xa is a bijection.

Since λa\lambda_a is surjective, there is an eGe\in G with ae=aae = a. We show this ee is a right identity. For any bGb\in G, surjectivity of ρa\rho_a gives a yGy\in G with b=yab = ya. Then, by associativity,

be=(ya)e=y(ae)=ya=b.be = (ya)e = y(ae) = ya = b .

So ee is a right identity for every element. Running the same argument starting from surjectivity of ρa\rho_a, we obtain an ee' with ea=ae'a = a, and using surjectivity of λa\lambda_a we find that eb=be'b = b for all bb. Taking b=eb = e gives ee=ee'e = e; on the other hand applying the right-identity property of ee to ee' gives ee=ee'e = e'. Hence e=ee = e', and ee is a two-sided identity.

Existence of inverses. Take aGa\in G. Since λa\lambda_a is surjective there is a bb with ab=eab = e, and since ρa\rho_a is surjective there is a cc with ca=eca = e. Then

c=ce=c(ab)=(ca)b=eb=bc = ce = c(ab) = (ca)b = eb = b

(the first step because ee is a right identity, the second by ab=eab=e, the third by associativity, the fourth by ca=eca=e, and the fifth because ee is a left identity). So b=cb = c is a two-sided inverse of aa. Associativity was assumed, so (G1), (G2) and (G3) all hold and GG is a group.

A counterexample in the infinite case. Take N={1,2,3,}\mathbb{N} = \{1,2,3,\ldots\} with addition. Associativity holds, and a+x=a+ya+x = a+y as well as x+a=y+ax+a = y+a imply x=yx=y, so both cancellation laws hold. But the only ee with n+e=nn + e = n is e=0e=0, and 0N0\notin\mathbb{N}, so there is no identity and N\mathbb{N} is not a group. Looking back at where finiteness was used in the proof, it enters at exactly one point: the inference “injective implies surjective”. For infinite sets that inference is unavailable (the map xx+1x\mapsto x+1 is injective on N\mathbb{N} but not surjective).


  • Kazuo Matsuzaka, Daisūkei Nyūmon, Iwanami Shoten, 1976 — Chapter 2, “Groups”. A standard introduction that proceeds from the group axioms to the isomorphism theorems with carefully chosen examples (in Japanese).
  • Akihiko Yukie, Daisūgaku 1: Gunron Nyūmon, Nippon Hyoronsha, 2010 — Chapters 1 and 2. Rich in computations with symmetric groups and concrete finite groups (in Japanese).
  • Toshiyuki Katsura, Daisūgaku I: Gun to Kan, University of Tokyo Press, 2004 — Chapter 1. Concise, with a clear link to linear algebra (in Japanese).
  • Michael Artin, Algebra, 2nd ed., Pearson, 2011 — Chapter 2, “Groups”. Builds group theory around matrix groups and symmetry, with a substantial treatment of GL(n,R)GL(n,\mathbb{R}).
  • Joseph J. Rotman, An Introduction to the Theory of Groups, 4th ed., Springer (GTM 148), 1995 — Chapters 1–2. Contains a detailed treatment of permutation groups.
  • Arthur Cayley, “On the theory of groups, as depending on the symbolic equation θn=1\theta^n = 1”, Philosophical Magazine (4th series) 7 (1854) — the original paper in which the definition of an abstract group and its multiplication table first appear.

Appendix: How far can the group axioms be weakened?

Section titled “Appendix: How far can the group axioms be weakened?”

Are one-sided axioms enough? In Definition 3.1 we required both the identity and the inverses to be two-sided. This is in fact redundant: assuming only one side suffices, provided the sides match (both left, or both right).

Proposition 7.5A left identity and left inverses suffice

Let a binary operation on a nonempty set GG satisfy associativity (G1) together with

  • (G2’) there is an eGe\in G with ea=aea = a for all aGa\in G (a left identity);
  • (G3’) for each aGa\in G there is an aGa'\in G with aa=ea'a = e (a left inverse).

Then (G,)(G,\cdot) is a group.

Proof(Proposition 7.5)

Take aGa\in G, use (G3’) to get aa' with aa=ea'a = e, and apply (G3’) again to aa' to get aa'' with aa=ea''a' = e.

First we show aa=eaa' = e:

aa=e(aa)=(aa)(aa)=a((aa)a)=a(ea)=aa=e.aa' = e(aa') = (a''a')(aa') = a''\bigl((a'a)a'\bigr) = a''(ea') = a''a' = e .

The first equality is (G2’), the second is aa=ea''a'=e, the third is a regrouping by associativity (G1), the fourth is aa=ea'a = e, the fifth is (G2’), and the sixth is aa=ea''a'=e. So aa' is also a right inverse of aa.

Next we show ae=aae = a. Using the relation aa=eaa' = e just proved together with aa=ea'a=e from (G3’),

ae=a(aa)=(aa)a=ea=aae = a(a'a) = (aa')a = ea = a

(using (G1) and (G2’)). So ee is also a right identity. This establishes (G2) and (G3), and GG is a group.

The sides must not be mixed. Weakening to “left identity + right inverse” destroys the statement. On a set GG with G2|G|\ge 2, define the operation xy:=yx\cdot y := y (return the right-hand argument). Associativity holds, since (xy)z=z(xy)z = z and x(yz)=zx(yz) = z. Every uGu\in G is a left identity (as ux=xu\cdot x = x). Fixing some eGe\in G, we have ae=ea\cdot e = e for every aa, so if we regard ee as the left identity, every element has ee as a right inverse. Yet this GG is not a group. If it were, the cancellation law, part (3) of Proposition 3.2, would hold; but for two elements xyx \ne y we have xe=e=yex\cdot e = e = y\cdot e while xyx \ne y, so right cancellation fails. When weakening the axioms, the “side” of the identity and of the inverses must be kept consistent.

Why do textbooks state both sides? Even though Proposition 7.5 is available, the definition is given in two-sided form because, when working with concrete groups, one wants to use the two-sided identities directly. A weaker definition reduces the number of items to verify but forces you to route every use through this proposition. Conversely, when the task is to prove that some set is a group, Proposition 7.5 halves the work.

Report an error in this article ・Operated by: Mugen Giken LLCPricingTermsLegal notice

© 2026 夢現技研合同会社 ・Feeding the text to an LLM is welcome. Code samples are MIT licensed.